2-(4-aminophenyl)-7-methoxychromen-4-one structure
|
Common Name | 2-(4-aminophenyl)-7-methoxychromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 921942-36-1 | Molecular Weight | 267.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-aminophenyl)-7-methoxychromen-4-one |
|---|
| Molecular Formula | C16H13NO3 |
|---|---|
| Molecular Weight | 267.27900 |
| Exact Mass | 267.09000 |
| PSA | 65.46000 |
| LogP | 3.63200 |
| InChIKey | XLOKPABQQSZDOA-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(=O)cc(-c3ccc(N)cc3)oc2c1 |
|
~%
2-(4-aminopheny... CAS#:921942-36-1 |
| Literature: Anand; Venkataraman Proceedings - Indian Academy of Sciences, Section A, 1947 , # 26 p. 279,282 |
|
~%
2-(4-aminopheny... CAS#:921942-36-1 |
| Literature: Anand; Venkataraman Proceedings - Indian Academy of Sciences, Section A, 1947 , # 26 p. 279,282 |