6-METHOXY-3-NITRO-2H-CHROMENE) structure
|
Common Name | 6-METHOXY-3-NITRO-2H-CHROMENE) | ||
|---|---|---|---|---|
| CAS Number | 92210-61-2 | Molecular Weight | 207.18300 | |
| Density | 1.344g/cm3 | Boiling Point | 347.759ºC at 760 mmHg | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.07ºC | |
| Name | 6-Methoxy-3-nitro-2H-chromene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 347.759ºC at 760 mmHg |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18300 |
| Flash Point | 168.07ºC |
| Exact Mass | 207.05300 |
| PSA | 64.28000 |
| LogP | 2.22840 |
| Index of Refraction | 1.595 |
| InChIKey | JSEAVEVSSXGINF-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C=C([N+](=O)[O-])CO2 |
| HS Code | 2909199090 |
|---|
|
~70%
6-METHOXY-3-NIT... CAS#:92210-61-2 |
| Literature: Neirabeyeh, Mamdouh Al; Koussini, Rafik Synthetic Communications, 1990 , vol. 20, # 6 p. 783 - 788 |
|
~85%
6-METHOXY-3-NIT... CAS#:92210-61-2 |
| Literature: Viaud; Mamai; Guerin; Bennejean; Renard; Delagrange; Guardiola-Lemaitre; Howell; Guillaumet Pharmacy and Pharmacology Communications, 1998 , vol. 4, # 1 p. 47 - 56 |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2H-1-Benzopyran,6-methoxy-3-nitro |
| 6-methoxy-3-nitro-2H-1-benzopyran |