12-O-Tiglylphorbol-13-isobutyrate structure
|
Common Name | 12-O-Tiglylphorbol-13-isobutyrate | ||
|---|---|---|---|---|
| CAS Number | 92214-54-5 | Molecular Weight | 516.62300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H40O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 12-O-Tiglylphorbol-13-isobutyrate12-O-Tiglylphorbol-13-isobutyrate is a phorbol diester constituent of Croton tiglium L. seed oil (croton oil)[1]. |
| Name | 12-O-tiglylphorbol-13-isobutyrate |
|---|
| Description | 12-O-Tiglylphorbol-13-isobutyrate is a phorbol diester constituent of Croton tiglium L. seed oil (croton oil)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H40O8 |
|---|---|
| Molecular Weight | 516.62300 |
| Exact Mass | 516.27200 |
| PSA | 130.36000 |
| LogP | 2.65410 |
| InChIKey | MVWXLRYZCZSBKW-QHEALFSCSA-N |
| SMILES | CC=C(C)C(=O)OC1C(C)C2(O)C(C=C(CO)CC3(O)C(=O)C(C)=CC32)C2C(C)(C)C12OC(=O)C(C)C |
| Hazard Codes | Xn |
|---|