4-(4-fluoro-N-(4-fluorophenyl)anilino)benzaldehyde structure
|
Common Name | 4-(4-fluoro-N-(4-fluorophenyl)anilino)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 922495-38-3 | Molecular Weight | 309.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-fluoro-N-(4-fluorophenyl)anilino)benzaldehyde |
|---|
| Molecular Formula | C19H13F2NO |
|---|---|
| Molecular Weight | 309.30900 |
| Exact Mass | 309.09700 |
| PSA | 20.31000 |
| LogP | 5.24710 |
| InChIKey | BTMLFNJFQASNPF-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(N(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
|
~70%
4-(4-fluoro-N-(... CAS#:922495-38-3 |
| Literature: He, Ze; Kan, Chi-Wai; Ho, Cheuk-Lam; Wong, Wai-Yeung; Chui, Chung-Hin; Tong, Ka-Lap; So, Shu-Kong; Lee, Tik-Ho; Leung, Louis M.; Lin, Zhenyang Dyes and Pigments, 2011 , vol. 88, # 3 p. 333 - 343 |
|
~%
4-(4-fluoro-N-(... CAS#:922495-38-3 |
| Literature: He, Ze; Kan, Chi-Wai; Ho, Cheuk-Lam; Wong, Wai-Yeung; Chui, Chung-Hin; Tong, Ka-Lap; So, Shu-Kong; Lee, Tik-Ho; Leung, Louis M.; Lin, Zhenyang Dyes and Pigments, 2011 , vol. 88, # 3 p. 333 - 343 |
|
~%
4-(4-fluoro-N-(... CAS#:922495-38-3 |
| Literature: He, Ze; Kan, Chi-Wai; Ho, Cheuk-Lam; Wong, Wai-Yeung; Chui, Chung-Hin; Tong, Ka-Lap; So, Shu-Kong; Lee, Tik-Ho; Leung, Louis M.; Lin, Zhenyang Dyes and Pigments, 2011 , vol. 88, # 3 p. 333 - 343 |