1,3-bis(2-diphenylphosphorylphenyl)urea structure
|
Common Name | 1,3-bis(2-diphenylphosphorylphenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 92269-75-5 | Molecular Weight | 612.59300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H30N2O3P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(2-diphenylphosphorylphenyl)urea |
|---|
| Molecular Formula | C37H30N2O3P2 |
|---|---|
| Molecular Weight | 612.59300 |
| Exact Mass | 612.17300 |
| PSA | 98.38000 |
| LogP | 6.69600 |
| InChIKey | PYGDNZUILASRRO-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1P(=O)(c1ccccc1)c1ccccc1)Nc1ccccc1P(=O)(c1ccccc1)c1ccccc1 |
|
~%
1,3-bis(2-diphe... CAS#:92269-75-5 |
| Literature: Baceiredo,A.; Bertrand,G.; Majoral,J.P. Journal of the American Chemical Society, 1984 , vol. 106, p. 7065 |
|
~%
1,3-bis(2-diphe... CAS#:92269-75-5 |
| Literature: Baceiredo,A.; Bertrand,G.; Majoral,J.P. Journal of the American Chemical Society, 1984 , vol. 106, p. 7065 |
|
~%
1,3-bis(2-diphe... CAS#:92269-75-5 |
| Literature: Baceiredo,A.; Bertrand,G.; Majoral,J.P. Journal of the American Chemical Society, 1984 , vol. 106, p. 7065 |