1-(2,2-dimethoxy-2-phenylethoxy)-2-iodo-4-methylbenzene structure
|
Common Name | 1-(2,2-dimethoxy-2-phenylethoxy)-2-iodo-4-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 923595-07-7 | Molecular Weight | 398.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,2-dimethoxy-2-phenylethoxy)-2-iodo-4-methylbenzene |
|---|
| Molecular Formula | C17H19IO3 |
|---|---|
| Molecular Weight | 398.23500 |
| Exact Mass | 398.03800 |
| PSA | 27.69000 |
| LogP | 4.12420 |
| InChIKey | LRWISDXYGDTWPB-UHFFFAOYSA-N |
| SMILES | COC(COc1ccc(C)cc1I)(OC)c1ccccc1 |
|
~%
1-(2,2-dimethox... CAS#:923595-07-7 |
| Literature: Liu, Guixia; Lu, Xiyan Journal of the American Chemical Society, 2006 , vol. 128, # 51 p. 16504 - 16505 |
|
~%
1-(2,2-dimethox... CAS#:923595-07-7 |
| Literature: Liu, Guixia; Lu, Xiyan Journal of the American Chemical Society, 2006 , vol. 128, # 51 p. 16504 - 16505 |