2-Amino-5-[(3,4,5-Trimethoxyphenyl)Methyl]-1H-Pyrimidin-4-One structure
|
Common Name | 2-Amino-5-[(3,4,5-Trimethoxyphenyl)Methyl]-1H-Pyrimidin-4-One | ||
|---|---|---|---|---|
| CAS Number | 92440-76-1 | Molecular Weight | 291.30200 | |
| Density | 1.31g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-5-[(3,4,5-trimethoxyphenyl)methyl]-1H-pyrimidin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.30200 |
| Exact Mass | 291.12200 |
| PSA | 100.45000 |
| LogP | 1.31110 |
| Index of Refraction | 1.587 |
| InChIKey | ZKFZTBRMADDRMK-UHFFFAOYSA-N |
| SMILES | COc1cc(Cc2cnc(N)[nH]c2=O)cc(OC)c1OC |
| HS Code | 2933599090 |
|---|
|
~30%
2-Amino-5-[(3,4... CAS#:92440-76-1 |
| Literature: Hess; Doelker; Haferburg; Kertscher; Matysik; Ortwein; Teubert; Zimmermann; Eger Pharmazie, 2001 , vol. 56, # 4 p. 306 - 310 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 296-233-2 |
| 2-Amino-5-[(3,4,5-Trimethoxyphenyl)Methyl]-1H-Pyrimidin-4-One |
| 2-Amino-5-(3,4,5-Trimethoxybenzyl)-3H-Pyrimidin-4-One |