1-[1-(2-chlorophenyl)pyrazol-4-yl]ethanone
Modify Date: 2025-08-25 18:14:42
![1-[1-(2-chlorophenyl)pyrazol-4-yl]ethanone Structure](https://image.chemsrc.com/caspic/460/925155-57-3.png)
1-[1-(2-chlorophenyl)pyrazol-4-yl]ethanone structure
|
Common Name | 1-[1-(2-chlorophenyl)pyrazol-4-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 925155-57-3 | Molecular Weight | 220.65500 | |
| Density | 1.269g/cm3 | Boiling Point | 350.153ºC at 760 mmHg | |
| Molecular Formula | C11H9ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.567ºC | |
| Name | 1-[1-(2-chlorophenyl)pyrazol-4-yl]ethanone |
|---|
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 350.153ºC at 760 mmHg |
| Molecular Formula | C11H9ClN2O |
| Molecular Weight | 220.65500 |
| Flash Point | 165.567ºC |
| Exact Mass | 220.04000 |
| PSA | 34.89000 |
| LogP | 2.72830 |
| Index of Refraction | 1.612 |
| InChIKey | MHYWAOIBAMAHGO-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cnn(-c2ccccc2Cl)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |