Arsine,tris(3-methoxyphenyl)- structure
|
Common Name | Arsine,tris(3-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 92533-93-2 | Molecular Weight | 396.31100 | |
| Density | N/A | Boiling Point | 487.8ºC at 760mmHg | |
| Molecular Formula | C21H21AsO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.4ºC | |
| Name | tris(3-methoxyphenyl)arsane |
|---|
| Boiling Point | 487.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C21H21AsO3 |
| Molecular Weight | 396.31100 |
| Flash Point | 167.4ºC |
| Exact Mass | 396.07100 |
| PSA | 27.69000 |
| LogP | 2.22860 |
| InChIKey | CMJISGFPYXRNJJ-UHFFFAOYSA-N |
| SMILES | COc1cccc([As](c2cccc(OC)c2)c2cccc(OC)c2)c1 |
|
~%
Arsine,tris(3-m... CAS#:92533-93-2 |
| Literature: Blicke; Cataline Journal of the American Chemical Society, 1938 , vol. 60, p. 419,420 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |