3-Isomangostin hydrate formate
Modify Date: 2025-08-25 17:43:33
3-Isomangostin hydrate formate structure
|
Common Name | 3-Isomangostin hydrate formate | ||
|---|---|---|---|---|
| CAS Number | 925705-36-8 | Molecular Weight | 456.485 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 642.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H28O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.2±25.0 °C | |
| Name | 3-Isomangostin hydrate formate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 642.3±55.0 °C at 760 mmHg |
| Molecular Formula | C25H28O8 |
| Molecular Weight | 456.485 |
| Flash Point | 217.2±25.0 °C |
| Exact Mass | 456.178406 |
| PSA | 115.43000 |
| LogP | 4.50 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | KQUSCBSXBQXBQP-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc2oc3cc4c(c(O)c3c(=O)c2c1CCC(C)(C)OC=O)CCC(C)(C)O4.O |
| Hazard Codes | Xi |
|---|
|
Name: Cytotoxicity against human HT-29 cells after 3 days by sulforhodamine B assay
Source: ChEMBL
Target: HT-29
External Id: CHEMBL1785169
|
|
Name: Effect on mitochondrial membrane potential in human HT-29 cells after 2 hrs using JC-...
Source: ChEMBL
Target: HT-29
External Id: CHEMBL1785172
|
|
Name: Inhibition of NFkappa p65 in nuclear extract of human HeLa cells assessed as blockade...
Source: ChEMBL
Target: Transcription factor p65
External Id: CHEMBL1785171
|
Total 3, Current Page 1 of 1
1
| 4-(5,9-Dihydroxy-8-methoxy-2,2-dimethyl-6-oxo-3,4-dihydro-2H,6H-pyrano[3,2-b]xanthen-7-yl)-2-methyl-2-butanyl formate |