15S-hydroxyeicosatrienoic acid structure
|
Common Name | 15S-hydroxyeicosatrienoic acid | ||
|---|---|---|---|---|
| CAS Number | 92693-02-2 | Molecular Weight | 322.482 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 487.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C20H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.7±23.8 °C | |
Use of 15S-hydroxyeicosatrienoic acid15(S)-HETrE is an inhibitor of 5-LO in human PMNL with an IC50 value of 4.6 M. |
| Name | (15S)-15-hydroxyicosa-8,11,13-trienoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.4±40.0 °C at 760 mmHg |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.482 |
| Flash Point | 262.7±23.8 °C |
| Exact Mass | 322.250793 |
| PSA | 57.53000 |
| LogP | 5.87 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | IUKXMNDGTWTNTP-IBGZPJMESA-N |
| SMILES | CCCCCC(O)C=CC=CCC=CCCCCCCC(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 8,11,13-Eicosatrienoic acid, 15-hydroxy-, (8Z,11Z,13E,15S)- |
| (8Z,11Z,13E,15S)-15-Hydroxy-8,11,13-icosatrienoic acid |
| 15(S)-HETrE |
| L-15-Hydroxy-8cis,11cis,13trans-eicosatriencarbonsaeure |