5-(3,5-dichlorophenyl)-1h-tetrazole structure
|
Common Name | 5-(3,5-dichlorophenyl)-1h-tetrazole | ||
|---|---|---|---|---|
| CAS Number | 92712-49-7 | Molecular Weight | 215.03900 | |
| Density | 1.574g/cm3 | Boiling Point | 410.2ºC at 760mmHg | |
| Molecular Formula | C7H4Cl2N4 | Melting Point | 205-208ºC | |
| MSDS | N/A | Flash Point | 234.3ºC | |
| Name | 5-(3,5-dichlorophenyl)-1h-tetrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.574g/cm3 |
|---|---|
| Boiling Point | 410.2ºC at 760mmHg |
| Melting Point | 205-208ºC |
| Molecular Formula | C7H4Cl2N4 |
| Molecular Weight | 215.03900 |
| Flash Point | 234.3ºC |
| Exact Mass | 213.98100 |
| PSA | 54.46000 |
| LogP | 2.17350 |
| Index of Refraction | 1.641 |
| InChIKey | VCYMSAGOTYBIHM-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(-c2nn[nH]n2)c1 |
|
~%
5-(3,5-dichloro... CAS#:92712-49-7 |
| Literature: Koyama; Ohtani; Kai; Moriguchi; Inouye Journal of Medicinal Chemistry, 1987 , vol. 30, # 3 p. 552 - 562 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| MFCD02093955 |