GMI-1070 structure
|
Common Name | GMI-1070 | ||
|---|---|---|---|---|
| CAS Number | 927881-99-0 | Molecular Weight | 1447.425 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C58H74N6O31S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GMI-1070Rivipansel (GMI-1070) is a potent E-selectin antagonist. Rivipansel prevents interaction between leukocytes and vascular endothelium. Rivipansel has the potential for the research of sickle cell vaso-occlusive crisis[1][2]. |
| Name | Rivipansel |
|---|---|
| Synonym | More Synonyms |
| Description | Rivipansel (GMI-1070) is a potent E-selectin antagonist. Rivipansel prevents interaction between leukocytes and vascular endothelium. Rivipansel has the potential for the research of sickle cell vaso-occlusive crisis[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Molecular Formula | C58H74N6O31S3 |
| Molecular Weight | 1447.425 |
| Exact Mass | 1446.356079 |
| LogP | -0.62 |
| Index of Refraction | 1.693 |
| InChIKey | VXBNTHRZPJLRSS-PTCSXESPSA-N |
| SMILES | CC1OC(OC2C(NC(=O)c3cc(=O)[nH]c(=O)[nH]3)CC(C(=O)NCCNC(=O)COCCOCC(=O)Nc3cc(S(=O)(=O)O)cc4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)CC2OC2OC(CO)C(O)C(OC(CC3CCCCC3)C(=O)O)C2OC(=O)c2ccccc2)C(O)C(O)C1O |
| 4B115V09LB |
| GMI-1070 |
| PF-06460031 |
| (1R,2R,3S,5R)-2-[(6-Deoxy-α-L-galactopyranosyl)oxy]-3-{[(2,6-dioxo-1,2,3,6-tetrahydro-4-pyrimidinyl)carbonyl]amino}-5-[(2-{[(2-{2-oxo-2-[(3,6,8-trisulfo-1-naphthyl)amino]ethoxy}ethoxy)acetyl]amino }ethyl)carbamoyl]cyclohexyl 2-O-benzoyl-3-O-[(1S)-1-carboxy-2-cyclohexylethyl]-β-D-galactopyranoside |
| 9776 |
| β-D-Galactopyranoside, (1R,2R,3S,5R)-2-[(6-deoxy-α-L-galactopyranosyl)oxy]-3-[[(1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinyl)carbonyl]amino]-5-[1,6,13-trioxo-13-[(3,6,8-trisulfo-1-naphthalenyl)am ino]-8,11-dioxa-2,5-diazatridec-1-yl]cyclohexyl 3-O-[(1S)-1-carboxy-2-cyclohexylethyl]-, 2-benzoate |
| Rivipansel |