2,4-bis(4-chlorophenyl)-4H-benzo[h][3,1]benzothiazine structure
|
Common Name | 2,4-bis(4-chlorophenyl)-4H-benzo[h][3,1]benzothiazine | ||
|---|---|---|---|---|
| CAS Number | 92825-05-3 | Molecular Weight | 420.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H15Cl2NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-bis(4-chlorophenyl)-4H-benzo[h][3,1]benzothiazine |
|---|
| Molecular Formula | C24H15Cl2NS |
|---|---|
| Molecular Weight | 420.35400 |
| Exact Mass | 419.03000 |
| PSA | 37.66000 |
| LogP | 7.49670 |
| InChIKey | DYURNSWCGOQLRG-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C2=Nc3c(ccc4ccccc34)C(c3ccc(Cl)cc3)S2)cc1 |
|
~34%
2,4-bis(4-chlor... CAS#:92825-05-3 |
| Literature: Nomura, Yujiro; Hayama, Takashi; Takeuchi, Yoshito; Tomoda, Shuji; Kato, Yuko Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 5 p. 1276 - 1278 |