1,1,2-Ethanetricarboxylic Acid, 2-(1,1-Dimethylethyl)1,1-Dimethyl Ester structure
|
Common Name | 1,1,2-Ethanetricarboxylic Acid, 2-(1,1-Dimethylethyl)1,1-Dimethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 92828-40-5 | Molecular Weight | 246.257 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 289.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C11H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.6±21.8 °C | |
| Name | 1,1,2-Ethanetricarboxylic Acid, 2-(1,1-Dimethylethyl)1,1-Dimethyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 289.8±20.0 °C at 760 mmHg |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.257 |
| Flash Point | 121.6±21.8 °C |
| Exact Mass | 246.110336 |
| PSA | 78.90000 |
| LogP | 1.30 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.440 |
| InChIKey | CNMLOQHPXARKOA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC(=O)OC(C)(C)C)C(=O)OC |
|
~40%
1,1,2-Ethanetri... CAS#:92828-40-5 |
| Literature: Laurent, Jean-Pierre; Morvan, Bernard Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1993 , # 14 p. 2141 - 2146 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1,2-Ethanetricarbo |
| 1,1,2-Ethanetricarboxylic acid, 2-(1,1-dimethylethyl) 1,1-dimethyl ester |
| TERT-BUTYLOXYCARBOXYLMETHYLMALONATE |
| 1,1-Dimethyl 2-(2-methyl-2-propanyl) 1,1,2-ethanetricarboxylate |