8-Methyl-2-phenyl-4-quinolinol structure
|
Common Name | 8-Methyl-2-phenyl-4-quinolinol | ||
|---|---|---|---|---|
| CAS Number | 92855-38-4 | Molecular Weight | 235.28100 | |
| Density | 1.173g/cm3 | Boiling Point | 402.3ºC at 760 mmHg | |
| Molecular Formula | C16H13NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 159.6ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 8-Methyl-2-phenyl-4-quinolinol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 402.3ºC at 760 mmHg |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.28100 |
| Flash Point | 159.6ºC |
| Exact Mass | 235.10000 |
| PSA | 33.12000 |
| LogP | 3.91580 |
| Index of Refraction | 1.623 |
| InChIKey | NGUWFPQUQMBYJN-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c(=O)cc(-c3ccccc3)[nH]c12 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318-H413 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933499090 |
|
~%
8-Methyl-2-phen... CAS#:92855-38-4 |
| Literature: Hauser; Reynolds Journal of the American Chemical Society, 1948 , vol. 70, p. 2402 |
|
~%
8-Methyl-2-phen... CAS#:92855-38-4 |
| Literature: Bangdiwala; Desai Journal of the Indian Chemical Society, 1954 , vol. 31, p. 711 |
|
~%
8-Methyl-2-phen... CAS#:92855-38-4 |
| Literature: Bangdiwala; Desai Journal of the Indian Chemical Society, 1954 , vol. 31, p. 711 |
|
~%
8-Methyl-2-phen... CAS#:92855-38-4 |
| Literature: Bangdiwala; Desai Journal of the Indian Chemical Society, 1954 , vol. 31, p. 711 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-methyl-2-phenyl-quinolin-4-ol |
| 2-Phenyl-8-methyl-4-hydroxychinolin |
| 8-Methyl-2-phenyl-chinolin-4-ol |
| 4-Hydroxy-8-methyl-2-phenyl-chinolin |
| 4-Hydroxy-8-methyl-2-phenylquinoline |