9-nitro-9,10-dihydro-9,10-ethanoanthracene structure
|
Common Name | 9-nitro-9,10-dihydro-9,10-ethanoanthracene | ||
|---|---|---|---|---|
| CAS Number | 92855-57-7 | Molecular Weight | 251.28000 | |
| Density | 1.31g/cm3 | Boiling Point | 409.6ºC at 760 mmHg | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.7ºC | |
| Name | 9-nitro-9,10-dihydro-9,10-ethanoanthracene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 409.6ºC at 760 mmHg |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28000 |
| Flash Point | 195.7ºC |
| Exact Mass | 251.09500 |
| PSA | 45.82000 |
| LogP | 3.96920 |
| Index of Refraction | 1.678 |
| InChIKey | WQIZJRFDJINJNH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C12CCC(c3ccccc31)c1ccccc12 |
|
~%
9-nitro-9,10-di... CAS#:92855-57-7 |
| Literature: Meek,J.S. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 4281 - 4285 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Nitro-dibenzobicyclo<2.2.2>octa-2,5-dien |
| 9-Nitro-9,10-dihydro-9,10-aethano-anthracen |