1-(2-ethylhexoxy)-N-phenyl-methanimidamide structure
|
Common Name | 1-(2-ethylhexoxy)-N-phenyl-methanimidamide | ||
|---|---|---|---|---|
| CAS Number | 92860-15-6 | Molecular Weight | 248.36400 | |
| Density | 0.98g/cm3 | Boiling Point | 351.8ºC at 760 mmHg | |
| Molecular Formula | C15H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.6ºC | |
| Name | 2-ethylhexyl N'-phenylcarbamimidate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 351.8ºC at 760 mmHg |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.36400 |
| Flash Point | 166.6ºC |
| Exact Mass | 248.18900 |
| PSA | 45.11000 |
| LogP | 4.43900 |
| Index of Refraction | 1.508 |
| InChIKey | DLEBDJHILKQZMF-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(N)=Nc1ccccc1 |
|
~%
1-(2-ethylhexox... CAS#:92860-15-6 |
| Literature: Forman,S.E. et al. Journal of Organic Chemistry, 1963 , vol. 28, p. 2653 - 2658 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Phenyl-2-<2-aethyl-hexyl>-isoharnstoff |