2-Bromo-1-(2-bromo-4-nitrophenyl)ethanone structure
|
Common Name | 2-Bromo-1-(2-bromo-4-nitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 928709-80-2 | Molecular Weight | 322.93800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5Br2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Bromo-1-(2-bromo-4-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5Br2NO3 |
|---|---|
| Molecular Weight | 322.93800 |
| Exact Mass | 320.86400 |
| PSA | 62.89000 |
| LogP | 3.45810 |
| InChIKey | AHYJTAWYAYMUDE-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc([N+](=O)[O-])cc1Br |
| HS Code | 2914700090 |
|---|
|
~%
2-Bromo-1-(2-br... CAS#:928709-80-2 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY; CORTE, James, R.; FANG, Tianan; DECICCO, Carl, P.; PINTO, Donald, J., P.; ROSSI, Karen, A.; HU, Zilun; JEON, Yoon; QUAN, Mimi, L.; SMALLHEER, Joanne, M.; WANG, Yufeng; YANG, Wu Patent: WO2011/100401 A1, 2011 ; Location in patent: Page/Page column 141 ; |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD08753757 |