1-Methyl-2-nitro-3-(trifluoromethyl)benzene structure
|
Common Name | 1-Methyl-2-nitro-3-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 92891-23-1 | Molecular Weight | 205.134 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 220.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H6F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.1±27.3 °C | |
| Name | 2-Nitro-3-Methylbenzotrifluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 220.4±40.0 °C at 760 mmHg |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.134 |
| Flash Point | 87.1±27.3 °C |
| Exact Mass | 205.035065 |
| PSA | 45.82000 |
| LogP | 3.04 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | JTXZOTTYGWMNGR-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(F)(F)F)c1[N+](=O)[O-] |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2904909090 |
|
~27%
1-Methyl-2-nitr... CAS#:92891-23-1 |
| Literature: Monsanto Company Patent: US4467125 A1, 1984 ; |
|
~41%
1-Methyl-2-nitr... CAS#:92891-23-1
Detail
|
| Literature: Journal of Organic Chemistry, , vol. 51, # 20 p. 3903 - 3904 |
|
~%
1-Methyl-2-nitr... CAS#:92891-23-1 |
| Literature: AT341509DE2405479 , ; Chem.Abstr., , vol. 81, # 151817 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Methyl-2-nitro-3-(trifluoromethyl)benzene |
| Benzene, 1-methyl-2-nitro-3-(trifluoromethyl)- |