2-(2-aminophenyl)sulfanyl-N-phenylacetamide structure
|
Common Name | 2-(2-aminophenyl)sulfanyl-N-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 92906-38-2 | Molecular Weight | 258.33900 | |
| Density | 1.25g/cm3 | Boiling Point | 485.8ºC at 760 mmHg | |
| Molecular Formula | C14H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.6ºC | |
| Name | 2-(2-aminophenyl)sulfanyl-N-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 485.8ºC at 760 mmHg |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.33900 |
| Flash Point | 247.6ºC |
| Exact Mass | 258.08300 |
| PSA | 80.42000 |
| LogP | 3.65380 |
| Index of Refraction | 1.663 |
| InChIKey | FIIZCSYGHRNIJI-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1SCC(=O)Nc1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2930909090 |
|
~82%
2-(2-aminopheny... CAS#:92906-38-2 |
| Literature: Rajakumar, Perumal; Mohammed Abdul Rasheed; Balu; Murugesan Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 22 p. 7458 - 7467 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms1704l17 |