4-(N-Maleimido)benzophenone structure
|
Common Name | 4-(N-Maleimido)benzophenone | ||
|---|---|---|---|---|
| CAS Number | 92944-71-3 | Molecular Weight | 277.27400 | |
| Density | 1.33g/cm3 | Boiling Point | 472.9ºC at 760mmHg | |
| Molecular Formula | C17H11NO3 | Melting Point | 155-157ºC | |
| MSDS | Chinese USA | Flash Point | 223.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(Maleimido)benzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 472.9ºC at 760mmHg |
| Melting Point | 155-157ºC |
| Molecular Formula | C17H11NO3 |
| Molecular Weight | 277.27400 |
| Flash Point | 223.7ºC |
| Exact Mass | 277.07400 |
| PSA | 54.45000 |
| LogP | 2.41200 |
| Index of Refraction | 1.651 |
| InChIKey | OZIZEXQRIOURIJ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(N2C(=O)C=CC2=O)cc1 |
| Storage condition | 2-8℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2925190090 |
|
~%
4-(N-Maleimido)... CAS#:92944-71-3 |
| Literature: Monatshefte fur Chemie, , vol. 128, # 1 p. 91 - 102 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Subunit interactions in the clathrin-coated vesicle vacuolar (H(+))-ATPase complex.
J. Biol. Chem. 274(41) , 28909-15, (1999) The vacuolar (H(+))-ATPases (or V-ATPases) are structurally related to the F(1)F(0) ATP synthases of mitochondria, chloroplasts and bacteria, being composed of a peripheral (V(1)) and an integral (V(0... |
|
|
Using a low denaturant model to explore the conformational features of translocation-active SecA.
Biochemistry 51(7) , 1369-79, (2012) The SecA molecular nanomachine in bacteria uses energy from ATP hydrolysis to drive post-translational secretion of preproteins through the SecYEG translocon. Cytosolic SecA exists in a dimeric, "clos... |
|
|
A cross-linking study of the N-terminal extension of human cardiac troponin I.
Biochemistry 42(34) , 10324-32, (2003) Phosphorylation of the unique N-terminal extension of cardiac troponin I (TnI) by PKA modulates Ca(2+) release from the troponin complex. The mechanism by which phosphorylation affects Ca(2+) binding,... |
| 1-(4-benzoylphenyl)pyrrole-2,5-dione |