9H-Fluorene,2,7-dichloro-4-nitro- structure
|
Common Name | 9H-Fluorene,2,7-dichloro-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 92961-04-1 | Molecular Weight | 280.10600 | |
| Density | 1.521g/cm3 | Boiling Point | 433.6ºC at 760mmHg | |
| Molecular Formula | C13H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216ºC | |
| Name | 2,7-dichloro-4-nitro-9H-fluorene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.521g/cm3 |
|---|---|
| Boiling Point | 433.6ºC at 760mmHg |
| Molecular Formula | C13H7Cl2NO2 |
| Molecular Weight | 280.10600 |
| Flash Point | 216ºC |
| Exact Mass | 278.98500 |
| PSA | 45.82000 |
| LogP | 4.99600 |
| Index of Refraction | 1.687 |
| InChIKey | OCHIQVDAGYHTQJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)cc2c1-c1ccc(Cl)cc1C2 |
| HS Code | 2904909090 |
|---|
|
~%
9H-Fluorene,2,7... CAS#:92961-04-1 |
| Literature: Schidlo,W.; Sieglitz,A. Chemische Berichte, 1963 , vol. 96, p. 2595 - 2600 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,7-Dichlor-4-nitrofluoren |
| 2,7-Difluor-4-nitrofluoren |