tert-butyl-dimethyl-(1-phenylethoxy)silane structure
|
Common Name | tert-butyl-dimethyl-(1-phenylethoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 92976-56-2 | Molecular Weight | 236.42500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-dimethyl-(1-phenylethoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H24OSi |
|---|---|
| Molecular Weight | 236.42500 |
| Exact Mass | 236.16000 |
| PSA | 9.23000 |
| LogP | 4.76940 |
| InChIKey | BKWQFHUWGDSHLN-UHFFFAOYSA-N |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
|
~99%
tert-butyl-dime... CAS#:92976-56-2 |
| Literature: D'Sa, Bosco A.; McLeod, Dale; Verkade, John G. Journal of Organic Chemistry, 1997 , vol. 62, # 15 p. 5057 - 5061 |
|
~76%
tert-butyl-dime... CAS#:92976-56-2 |
| Literature: Yamamoto, Keiji; Takemae, Makoto Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 6 p. 2111 - 2113 |
|
~%
tert-butyl-dime... CAS#:92976-56-2 |
| Literature: Kim; Kee Tetrahedron Letters, 1990 , vol. 31, # 20 p. 2899 - 2900 |
| tert-butyldimethylsilyl 1-phenylethyl ether |
| 1-tert-butyldimethylsiloxyethylbenzene |
| 1-tert-butyldimethylsiloxy-1-phenylethane |
| 1-phenylethyl tert-butyldimethylsilyl ether |