2-chloro-N,N-bis(4-methoxyphenyl)ethanimidamide structure
|
Common Name | 2-chloro-N,N-bis(4-methoxyphenyl)ethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 93018-08-7 | Molecular Weight | 304.77100 | |
| Density | 1.15g/cm3 | Boiling Point | 469.5ºC at 760 mmHg | |
| Molecular Formula | C16H17ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.7ºC | |
| Name | 2-chloro-N,N'-bis(4-methoxyphenyl)ethanimidamide |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 469.5ºC at 760 mmHg |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.77100 |
| Flash Point | 237.7ºC |
| Exact Mass | 304.09800 |
| PSA | 42.85000 |
| LogP | 4.15770 |
| Index of Refraction | 1.553 |
| InChIKey | NRKNKNVFAWEECZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=C(CCl)Nc2ccc(OC)cc2)cc1 |
|
~%
2-chloro-N,N-bi... CAS#:93018-08-7 |
| Literature: Bauer,L.; Welsh,T.L. Journal of Organic Chemistry, 1962 , vol. 27, p. 4382 - 4385 |
|
~%
2-chloro-N,N-bi... CAS#:93018-08-7 |
| Literature: Bauer,L.; Welsh,T.L. Journal of Organic Chemistry, 1962 , vol. 27, p. 4382 - 4385 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |