6-bromo-4-chloro-2-propylquinoline structure
|
Common Name | 6-bromo-4-chloro-2-propylquinoline | ||
|---|---|---|---|---|
| CAS Number | 930570-34-6 | Molecular Weight | 284.57900 | |
| Density | 1.465g/cm3 | Boiling Point | 336.2ºC at 760 mmHg | |
| Molecular Formula | C12H11BrClN | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 157.1ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 6-bromo-4-chloro-2-propylquinoline |
|---|
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 336.2ºC at 760 mmHg |
| Molecular Formula | C12H11BrClN |
| Molecular Weight | 284.57900 |
| Flash Point | 157.1ºC |
| Exact Mass | 282.97600 |
| PSA | 12.89000 |
| LogP | 4.60320 |
| Index of Refraction | 1.628 |
| InChIKey | QYFOGUDLBMGKHS-UHFFFAOYSA-N |
| SMILES | CCCc1cc(Cl)c2cc(Br)ccc2n1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318-H413 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |