Propanedioic acid, 2-[(2-bromophenyl)methylene]-,1,3-diethyl ester structure
|
Common Name | Propanedioic acid, 2-[(2-bromophenyl)methylene]-,1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 93098-67-0 | Molecular Weight | 327.17100 | |
| Density | 1.386g/cm3 | Boiling Point | 362.1ºC at 760mmHg | |
| Molecular Formula | C14H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.8ºC | |
| Name | diethyl 2-[(2-bromophenyl)methylidene]propanedioate |
|---|
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 362.1ºC at 760mmHg |
| Molecular Formula | C14H15BrO4 |
| Molecular Weight | 327.17100 |
| Flash Point | 172.8ºC |
| Exact Mass | 326.01500 |
| PSA | 52.60000 |
| LogP | 2.95870 |
| Index of Refraction | 1.561 |
| InChIKey | ZZDNKHNYMZVZGJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=Cc1ccccc1Br)C(=O)OCC |
|
~99%
Propanedioic ac... CAS#:93098-67-0 |
| Literature: Ksander, Gary M.; De Jesus, Reynalda; Yuan, Andrew; Ghai; Trapani; McMartin, Colin; Bohacek, Regine Journal of Medicinal Chemistry, 1997 , vol. 40, # 4 p. 495 - 505 |
|
~68%
Propanedioic ac... CAS#:93098-67-0 |
| Literature: Beecham Group p.l.c. Patent: US4699995 A1, 1987 ; |