chlorocyclohexylmagnesium structure
|
Common Name | chlorocyclohexylmagnesium | ||
|---|---|---|---|---|
| CAS Number | 931-51-1 | Molecular Weight | 142.91000 | |
| Density | 0.871 g/mL at 25ºC | Boiling Point | 80.7ºC at 760 mmHg | |
| Molecular Formula | C6H11ClMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -40 °F | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | Cyclohexylmagnesium chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 0.871 g/mL at 25ºC |
|---|---|
| Boiling Point | 80.7ºC at 760 mmHg |
| Molecular Formula | C6H11ClMg |
| Molecular Weight | 142.91000 |
| Flash Point | -40 °F |
| Exact Mass | 142.04000 |
| LogP | 2.97780 |
| InChIKey | DEDWWARPYWCXMG-UHFFFAOYSA-M |
| SMILES | [CH-]1CCCCC1.[Cl-].[Mg+2] |
| Storage condition | Flammables + water-Freezer (-20°C)e area |
| Water Solubility | It reacts violently with water. |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H314 |
| Supplemental HS | May form explosive peroxides., Reacts violently with water. |
| Precautionary Statements | P210-P280-P305 + P351 + P338-P310 |
| Hazard Codes | F+: Highly flammable;C: Corrosive; |
| Risk Phrases | R12 |
| Safety Phrases | 7-9-16-26-29-33-36/37/39-43-45 |
| RIDADR | UN 3399 4 |
| WGK Germany | 1 |
| Hazard Class | 4.2 |
|
~%
chlorocyclohexy... CAS#:931-51-1 |
| Literature: New Journal of Chemistry, , vol. 27, # 3 p. 540 - 550 |
|
~%
chlorocyclohexy... CAS#:931-51-1 |
| Literature: EP1688424 A1, ; Page/Page column 69-70 ; |
| MFCD00003816 |
| magnesium,cyclohexane,chloride |