4-(2-fluorophenyl)-1,3-dihydroimidazole-2-thione structure
|
Common Name | 4-(2-fluorophenyl)-1,3-dihydroimidazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 93103-13-0 | Molecular Weight | 194.22900 | |
| Density | 1.39g/cm3 | Boiling Point | 304.5ºC at 760 mmHg | |
| Molecular Formula | C9H7FN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.9ºC | |
| Name | 4-(2-fluorophenyl)-1,3-dihydroimidazole-2-thione |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 304.5ºC at 760 mmHg |
| Molecular Formula | C9H7FN2S |
| Molecular Weight | 194.22900 |
| Flash Point | 137.9ºC |
| Exact Mass | 194.03100 |
| PSA | 67.48000 |
| LogP | 2.50450 |
| Index of Refraction | 1.682 |
| InChIKey | COMZTUHLRQVPAK-UHFFFAOYSA-N |
| SMILES | Fc1ccccc1-c1c[nH]c(=S)[nH]1 |
|
~62%
4-(2-fluorophen... CAS#:93103-13-0 |
| Literature: Maeda; Suzuki; Iwasaki; Matsumoto; Iwasawa Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 7 p. 2536 - 2543 |
|
~%
4-(2-fluorophen... CAS#:93103-13-0 |
| Literature: Maeda; Suzuki; Iwasaki; Matsumoto; Iwasawa Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 7 p. 2536 - 2543 |