DMT-dG(ib) Phosphoramidite structure
|
Common Name | DMT-dG(ib) Phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 93183-15-4 | Molecular Weight | 839.915 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H54N7O8P | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | N/A | |
Use of DMT-dG(ib) PhosphoramiditeDMT-dG(ib) Phosphoramidite is typically used in the synthesis of DNA[1]. |
| Name | DMT-dG(ib) Phosphoramidite |
|---|---|
| Synonym | More Synonyms |
| Description | DMT-dG(ib) Phosphoramidite is typically used in the synthesis of DNA[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C44H54N7O8P |
|---|---|
| Molecular Weight | 839.915 |
| Exact Mass | 839.377136 |
| PSA | 188.67000 |
| LogP | 7.22 |
| Appearance of Characters | white to off-white |
| InChIKey | FDRMKYVTIFSDPR-MMROLVBFSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cnc4c(=O)[nH]c(NC(=O)C(C)C)nc43)CC2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Storage condition | Store at -20°C |
| Water Solubility | soluble, clear |
| 5'-O-[Bis(4-methoxyphenyl)(phenyl)methyl]-3'-O-[(2-cyanoethoxy)(diisopropylamino)phosphino]-2'-deoxy-N-isobutyrylguanosine |
| Guanosine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-3'-O-[[bis(1-methylethyl)amino](2-cyanoethoxy)phosphino]-2'-deoxy-N-(2-methyl-1-oxopropyl)- |
| 5'-o-(4,4'-dimethoxytrityl)-n2-isobutyryl-2'-deoxyguanosine-3'-(2-cyanoethyl-n,n-diisopropyl)phosphoramidite |
| DMT-dG(iBu)-CE-Phosphoramidite |