Benzyl 2-carbamoyl-1-pyrrolidinecarboxylate structure
|
Common Name | Benzyl 2-carbamoyl-1-pyrrolidinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 93188-01-3 | Molecular Weight | 248.278 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 465.6±44.0 °C at 760 mmHg | |
| Molecular Formula | C13H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.4±28.4 °C | |
| Name | Benzyl 2-carbamoylpyrrolidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 465.6±44.0 °C at 760 mmHg |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.278 |
| Flash Point | 235.4±28.4 °C |
| Exact Mass | 248.116089 |
| PSA | 73.62000 |
| LogP | 0.22 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | ZCGHEBMEQXMRQL-UHFFFAOYSA-N |
| SMILES | NC(=O)C1CCCN1C(=O)OCc1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~85%
Benzyl 2-carbam... CAS#:93188-01-3 |
| Literature: Kalypsys, Inc. Patent: US2006/116515 A1, 2006 ; Location in patent: Page/Page column 66 ; US 20060116515 A1 |
|
~%
Benzyl 2-carbam... CAS#:93188-01-3 |
| Literature: Journal of Biological Chemistry, , vol. 193, p. 81,87 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzyl2-Carbamoylpyrrolidine-1-Carboxylate |
| 2-carbamoyl-pyrrolidine-1-carboxylic acid benzyl ester |
| 1-benzyloxycarbonyl-DL-prolin-amide |
| AB3070 |
| 1-Pyrrolidinecarboxylic acid, 2-(aminocarbonyl)-, phenylmethyl ester |
| Cbz-DL-prolinamide |
| Benzyl 2-carbamoyl-1-pyrrolidinecarboxylate |
| Z-DL-Pro-NH2 |
| (R)-2-carbamoyl-n-cbz-pyrrolidine |
| 1-Benzyloxycarbonyl-DL-prolin-amid |
| BENZYL 2-CARBAMOYLPYRROLIDINE-1-CARBOXYLATE |
| 2-(aminocarbonyl)-1-pyrrolidinecarboxylic acid,phenylmethyl ester |