4-(4-Bromophenyl)-2-chloropyrimidine structure
|
Common Name | 4-(4-Bromophenyl)-2-chloropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 932162-80-6 | Molecular Weight | 269.525 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 415.2±20.0 °C at 760 mmHg | |
| Molecular Formula | C10H6BrClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.9±21.8 °C | |
| Name | 4-(4-Bromophenyl)-2-chloropyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 415.2±20.0 °C at 760 mmHg |
| Molecular Formula | C10H6BrClN2 |
| Molecular Weight | 269.525 |
| Flash Point | 204.9±21.8 °C |
| Exact Mass | 267.940277 |
| PSA | 25.78000 |
| LogP | 3.17 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | KRYQVNMBOLJHAD-UHFFFAOYSA-N |
| SMILES | Clc1nccc(-c2ccc(Br)cc2)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrimidine, 4-(4-bromophenyl)-2-chloro- |
| 4-(4-Bromophenyl)-2-chloropyrimidine |