ethyl 6-methoxy-2-oxo-1H-quinoline-4-carboxylate structure
|
Common Name | ethyl 6-methoxy-2-oxo-1H-quinoline-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 93257-70-6 | Molecular Weight | 247.24700 | |
| Density | 1.247g/cm3 | Boiling Point | 461.6ºC at 760 mmHg | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233ºC | |
| Name | ethyl 6-methoxy-2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 461.6ºC at 760 mmHg |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.24700 |
| Flash Point | 233ºC |
| Exact Mass | 247.08400 |
| PSA | 68.39000 |
| LogP | 1.71340 |
| Index of Refraction | 1.556 |
| InChIKey | PNBJBGMPLMTKFP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(=O)[nH]c2ccc(OC)cc12 |
|
~%
ethyl 6-methoxy... CAS#:93257-70-6 |
| Literature: Thielepape; Fulde Chemische Berichte, 1939 , vol. 72, p. 1432,1438 |
|
~%
ethyl 6-methoxy... CAS#:93257-70-6 |
| Literature: Thielepape; Fulde Chemische Berichte, 1939 , vol. 72, p. 1432,1438 |
|
~%
ethyl 6-methoxy... CAS#:93257-70-6 |
| Literature: Thielepape; Fulde Chemische Berichte, 1939 , vol. 72, p. 1432,1438 |
|
~%
ethyl 6-methoxy... CAS#:93257-70-6 |
| Literature: Thielepape; Fulde Chemische Berichte, 1939 , vol. 72, p. 1432,1438 |
|
~%
ethyl 6-methoxy... CAS#:93257-70-6 |
| Literature: Thielepape; Fulde Chemische Berichte, 1939 , vol. 72, p. 1432,1438 |
|
~%
ethyl 6-methoxy... CAS#:93257-70-6 |
| Literature: Thielepape; Fulde Chemische Berichte, 1939 , vol. 72, p. 1432,1438 |
|
~%
ethyl 6-methoxy... CAS#:93257-70-6 |
| Literature: Ishikawa Chemical and Pharmaceutical Bulletin, 1958 , vol. 6, p. 71,74 |
| ethyl 6-methoxy-2-oxo-1,2-dihydroquinoline-4-carboxylate |
| 2-Hydroxychininsaeureethylester |
| 2-hydroxy-6-methoxy-quinoline-4-carboxylic acid ethyl ester |
| 2-Hydroxy-6-methoxy-chinolin-4-carbonsaeure-aethylester |