Glutaraldehyde-O-2,3,4,5,6-PFBHA-Oxime structure
|
Common Name | Glutaraldehyde-O-2,3,4,5,6-PFBHA-Oxime | ||
|---|---|---|---|---|
| CAS Number | 932710-48-0 | Molecular Weight | 490.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H12F10N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | glutaraldehyde O,O-di((perfluorophenyl)methyl) dioxime |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H12F10N2O2 |
|---|---|
| Molecular Weight | 490.29500 |
| Exact Mass | 490.07400 |
| PSA | 43.18000 |
| LogP | 5.95290 |
| InChIKey | YAGVMVPKFZBARN-IBLZLIEZSA-N |
| SMILES | Fc1c(F)c(F)c(CON=CCCCC=NOCc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H413 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| glutaraldehyde bis-(o-pentafluorophenylmethyloxime) |
| glutaraldehyde bis-(o-pentafluorophenylm |