[2,7-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-9H-fluoren-9-yl]methyl carbonochloridate structure
|
Common Name | [2,7-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-9H-fluoren-9-yl]methyl carbonochloridate | ||
|---|---|---|---|---|
| CAS Number | 932710-57-1 | Molecular Weight | 950.87700 | |
| Density | 1.567g/cm3 | Boiling Point | 529.1ºC at 760 mmHg | |
| Molecular Formula | C31H17ClF26O2 | Melting Point | 88-92ºC | |
| MSDS | Chinese USA | Flash Point | 93.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [2,7-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-9H-fluoren-9-yl]methyl carbonochloridate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.567g/cm3 |
|---|---|
| Boiling Point | 529.1ºC at 760 mmHg |
| Melting Point | 88-92ºC |
| Molecular Formula | C31H17ClF26O2 |
| Molecular Weight | 950.87700 |
| Flash Point | 93.5ºC |
| Exact Mass | 950.05000 |
| PSA | 26.30000 |
| LogP | 13.51710 |
| Index of Refraction | 1.403 |
| InChIKey | ZJELYAAWYLRRJI-UHFFFAOYSA-N |
| SMILES | O=C(Cl)OCC1c2cc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc2-c2ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| Chlorameisensaeure-[1,8-bis-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluornonyl)-9-fluorenyl]-methyl-ester |
| 2,7-Bis(1H,1H,2H,2H-perfluorooctyl)-9-fluorenylmethoxycarbonyl chloride |
| F26 Fmoc-Cl |
| [1,8-Bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)-9-fluorenyl]methyl chloroformate |