6,8-dimethyl-2-phenyl-1H-quinolin-4-one structure
|
Common Name | 6,8-dimethyl-2-phenyl-1H-quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 93315-54-9 | Molecular Weight | 249.30700 | |
| Density | 1.17g/cm3 | Boiling Point | 453.9ºC at 760 mmHg | |
| Molecular Formula | C17H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.3ºC | |
| Name | 6,8-dimethyl-2-phenyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 453.9ºC at 760 mmHg |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.30700 |
| Flash Point | 228.3ºC |
| Exact Mass | 249.11500 |
| PSA | 33.12000 |
| LogP | 4.22420 |
| Index of Refraction | 1.656 |
| InChIKey | JRPWMQRKZZMNLQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2[nH]c(-c3ccccc3)cc(=O)c2c1 |
| HS Code | 2933499090 |
|---|
|
~%
6,8-dimethyl-2-... CAS#:93315-54-9 |
| Literature: Bangdiwala; Desai Journal of the Indian Chemical Society, 1954 , vol. 31, p. 43,46 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,8-Dimethyl-2-phenyl-chinolin-4-ol |
| 4-Hydroxy-6,8-dimethyl-2-phenyl-chinolin |
| 2-Phenyl-6,8-dimethyl-4-hydroxychinolin |
| 6,8-dimethyl-2-phenyl-quinolin-4-ol |
| 6,8-Dimethyl-2-phenyl-4-quinolinol |
| 6,8-Dimethyl-4-hydroxy-2-phenylquinoline |