Ethanone,2-(1,3-benzodioxol-5-yl)-1-(1H-indol-3-yl)- structure
|
Common Name | Ethanone,2-(1,3-benzodioxol-5-yl)-1-(1H-indol-3-yl)- | ||
|---|---|---|---|---|
| CAS Number | 93325-40-7 | Molecular Weight | 279.29000 | |
| Density | 1.36g/cm3 | Boiling Point | 500.4ºC at 760mmHg | |
| Molecular Formula | C17H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.4ºC | |
| Name | 2-(1,3-benzodioxol-5-yl)-1-(1H-indol-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 500.4ºC at 760mmHg |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.29000 |
| Flash Point | 256.4ºC |
| Exact Mass | 279.09000 |
| PSA | 51.32000 |
| LogP | 3.32200 |
| Index of Refraction | 1.698 |
| InChIKey | XKURNVSKRZZDCH-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)c1c[nH]c2ccccc12 |
|
~%
Ethanone,2-(1,3... CAS#:93325-40-7 |
| Literature: Young,T.E.; Mizianty,M.F. Journal of Organic Chemistry, 1964 , vol. 29, p. 2030 - 2031 |
|
~%
Ethanone,2-(1,3... CAS#:93325-40-7 |
| Literature: Young,T.E.; Mizianty,M.F. Journal of Organic Chemistry, 1964 , vol. 29, p. 2030 - 2031 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3-<3,4-Methylendioxyphenylacetyl>-indol |