Benzoicacid, 4-methoxy-, 4-methyl-3-(2,2,2-trichloroethyl)phenyl ester structure
|
Common Name | Benzoicacid, 4-methoxy-, 4-methyl-3-(2,2,2-trichloroethyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 93330-59-7 | Molecular Weight | 373.65800 | |
| Density | 1.333g/cm3 | Boiling Point | 474.3ºC at 760mmHg | |
| Molecular Formula | C17H15Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.7ºC | |
| Name | [4-methyl-3-(2,2,2-trichloroethyl)phenyl] 4-methoxybenzoate |
|---|
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 474.3ºC at 760mmHg |
| Molecular Formula | C17H15Cl3O3 |
| Molecular Weight | 373.65800 |
| Flash Point | 175.7ºC |
| Exact Mass | 372.00900 |
| PSA | 35.53000 |
| LogP | 5.13550 |
| Index of Refraction | 1.581 |
| InChIKey | GVYYKCPAEPDMGG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Oc2ccc(C)c(CC(Cl)(Cl)Cl)c2)cc1 |
|
~%
Benzoicacid, 4-... CAS#:93330-59-7 |
| Literature: Newman,M.S.; Bayerlein,F. Journal of Organic Chemistry, 1963 , vol. 28, p. 2804 - 2806 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |