3,3'-Bis(5,6-diphenyl-1,2,4-triazine) structure
|
Common Name | 3,3'-Bis(5,6-diphenyl-1,2,4-triazine) | ||
|---|---|---|---|---|
| CAS Number | 93372-16-8 | Molecular Weight | 464.52000 | |
| Density | 1.238g/cm3 | Boiling Point | 693.1ºC at 760mmHg | |
| Molecular Formula | C30H20N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.3ºC | |
| Name | 3-(5,6-diphenyl-1,2,4-triazin-3-yl)-5,6-diphenyl-1,2,4-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 693.1ºC at 760mmHg |
| Molecular Formula | C30H20N6 |
| Molecular Weight | 464.52000 |
| Flash Point | 300.3ºC |
| Exact Mass | 464.17500 |
| PSA | 77.34000 |
| LogP | 6.39160 |
| Index of Refraction | 1.655 |
| InChIKey | QQFAPSRWCWFNGN-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nnc(-c3nnc(-c4ccccc4)c(-c4ccccc4)n3)nc2-c2ccccc2)cc1 |
| HS Code | 2933699090 |
|---|
|
~%
3,3'-Bis(5,6-di... CAS#:93372-16-8 |
| Literature: Dedichen Norske Vid.Akad.Avh., 1936 , # 5 p. 28 |
|
~93%
3,3'-Bis(5,6-di... CAS#:93372-16-8 |
| Literature: Breu, J.; Range, K.-J.; Herdtweck, E. Monatshefte fuer Chemie, 1994 , vol. 125, # 2 p. 119 - 140 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5,5',6,6'-tetraphenyl-3,3'-bi-1,2,4-triazine |
| 3,3'-Bis(5,6-diphenyl-1,2,4-triazin) |
| 5,6,5',6'-tetraphenyl-[3,3']bi[1,2,4]triazinyl |
| 3,3'-Bi-1,2,4-triazine,5,5',6,6'-tetraphenyl |
| 3,3'-Bi-1,2,4-triazin,5,5',6,6'-tetraphenyl |
| bis-(5,6-diphenyl-[1,2,4]-triazinyl)pyridine |
| 3,3'-bis(5,6-diphenyl)-1,2,4-triazine |