Methyl 4-bromo-2-(trifluoromethoxy)benzoate structure
|
Common Name | Methyl 4-bromo-2-(trifluoromethoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 933785-18-3 | Molecular Weight | 299.041 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 265.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H6BrF3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.6±25.9 °C | |
| Name | ethyl 4-bromo-2-(trifluoromethoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 265.9±35.0 °C at 760 mmHg |
| Molecular Formula | C9H6BrF3O3 |
| Molecular Weight | 299.041 |
| Flash Point | 114.6±25.9 °C |
| Exact Mass | 297.945221 |
| PSA | 35.53000 |
| LogP | 3.95 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | QDAATKCEXCYIPG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(Br)cc1OC(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~75%
Methyl 4-bromo-... CAS#:933785-18-3 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH Patent: US2012/28952 A1, 2012 ; Location in patent: Page/Page column 19 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl 4-bromo-2-(trifluoromethoxy)benzoate |
| Ethyl4-bromo-2-(trifluoromethoxy)benzoate |
| Benzoic acid, 4-bromo-2-(trifluoromethoxy)-, methyl ester |
| 4-Bromo-2-(trifluoromethoxy)benzoic acid methyl ester |