5,8-Quinolinedione, 6-acetamido-7-methoxy-
Modify Date: 2025-09-18 11:52:38
5,8-Quinolinedione, 6-acetamido-7-methoxy- structure
|
Common Name | 5,8-Quinolinedione, 6-acetamido-7-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 93404-61-6 | Molecular Weight | 246.21900 | |
| Density | 1.39g/cm3 | Boiling Point | 505.8ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.7ºC | |
| Name | 5,8-Quinolinedione, 6-acetamido-7-methoxy |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 505.8ºC at 760 mmHg |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.21900 |
| Flash Point | 259.7ºC |
| Exact Mass | 246.06400 |
| PSA | 85.36000 |
| LogP | 0.84560 |
| Index of Refraction | 1.595 |
| InChIKey | YLXDEMBWRKQZBI-UHFFFAOYSA-N |
| SMILES | COC1=C(NC(C)=O)C(=O)c2cccnc2C1=O |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| n-(7-methoxy-2,2,8-trimethyl-2h-chromen-6-yl)acetamide |
| 6-Acetamino-7-methoxy-chinolin-chinon-(5,8) |
| 6-Acetamido-7-methoxy-2,2,8-trimethyl-chromen |