3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid structure
|
Common Name | 3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 934664-21-8 | Molecular Weight | 389.13600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10F2INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-difluoro-2-(4-iodo-2-methylanilino)benzoic acid |
|---|
| Molecular Formula | C14H10F2INO2 |
|---|---|
| Molecular Weight | 389.13600 |
| Exact Mass | 388.97200 |
| PSA | 49.33000 |
| LogP | 4.39260 |
| InChIKey | XRNCNLRJMNWXRG-UHFFFAOYSA-N |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)O)ccc(F)c1F |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |