Karavilagenin D structure
|
Common Name | Karavilagenin D | ||
|---|---|---|---|---|
| CAS Number | 934739-29-4 | Molecular Weight | 470.684 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 595.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.0±23.6 °C | |
Use of Karavilagenin DKaravilagenin D, a cucurbitane-type triterpene isolated from Japanese bitter melon leaves, is a potential tumor-promoting inhibitor[1]. |
| Name | (1R,4S,5S,8R,9R,12S,13S,16S)-16-Hydroxy-8-[(2R,4E)-6-hydroxy-6-methyl-4-hepten-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-19-one |
|---|---|
| Synonym | More Synonyms |
| Description | Karavilagenin D, a cucurbitane-type triterpene isolated from Japanese bitter melon leaves, is a potential tumor-promoting inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 595.8±50.0 °C at 760 mmHg |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.684 |
| Flash Point | 188.0±23.6 °C |
| Exact Mass | 470.339600 |
| PSA | 66.76000 |
| LogP | 5.83 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | CUJVAMKVNDHSSR-RIYZIHGNSA-N |
| SMILES | CC(CC=CC(C)(C)O)C1CCC2(C)C3C=CC45OC(=O)C3(CCC12C)C4CCC(O)C5(C)C |
| Hazard Codes | Xi |
|---|
| (1R,4S,5S,8R,9R,12S,13S,16S)-16-Hydroxy-8-[(2R,4E)-6-hydroxy-6-methyl-4-hepten-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.0.0.0]nonadec-2-en-19-one |
| 5,9-(Epoxymethano)-2H-cyclopenta[a]phenanthren-18-one, 1,3,4,8,10,11,12,13,14,15,16,17-dodecahydro-3-hydroxy-17-[(1R,3E)-5-hydroxy-1,5-dimethyl-3-hexen-1-yl]-4,4,13,14-tetramethyl-, (3S,5R,8S,9S,10S,13R,14S,17R)- |