1H-BENZOIMIDAZOL-5-YLAMINE structure
|
Common Name | 1H-BENZOIMIDAZOL-5-YLAMINE | ||
|---|---|---|---|---|
| CAS Number | 93600-19-2 | Molecular Weight | 294.99200 | |
| Density | 1.502g/cm3 | Boiling Point | 349.7ºC at 760mmHg | |
| Molecular Formula | C11H7Cl4N | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 196.2ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 4-chloro-6-methyl-2-(trichloromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.502g/cm3 |
|---|---|
| Boiling Point | 349.7ºC at 760mmHg |
| Molecular Formula | C11H7Cl4N |
| Molecular Weight | 294.99200 |
| Flash Point | 196.2ºC |
| Exact Mass | 292.93300 |
| PSA | 12.89000 |
| LogP | 5.02330 |
| Index of Refraction | 1.642 |
| InChIKey | GERDLAGWORVXDD-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(C(Cl)(Cl)Cl)cc(Cl)c2c1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319-H413 |
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933499090 |
|
~%
1H-BENZOIMIDAZO... CAS#:93600-19-2 |
| Literature: US4599345 A1, ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Trichloromethyl-6-methyl-4-chloroquinoline |
| 2-trichloromethyl-6-methyl-4-chlorochinoline |
| QU009 |
| OR3613 |