(R)-3-Amino-4-(2,4,5-trifluorophenyl)butyric acid structure
|
Common Name | (R)-3-Amino-4-(2,4,5-trifluorophenyl)butyric acid | ||
|---|---|---|---|---|
| CAS Number | 936630-57-8 | Molecular Weight | 233.187 | |
| Density | 1.399 | Boiling Point | 326.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.3±27.9 °C | |
| Name | (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399 |
|---|---|
| Boiling Point | 326.6±42.0 °C at 760 mmHg |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.187 |
| Flash Point | 151.3±27.9 °C |
| Exact Mass | 233.066360 |
| PSA | 63.32000 |
| LogP | 1.50 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | KEFQQJVYCWLKPL-ZCFIWIBFSA-N |
| SMILES | NC(CC(=O)O)Cc1cc(F)c(F)cc1F |
| HS Code | 2922499990 |
|---|
|
~95%
(R)-3-Amino-4-(... CAS#:936630-57-8 |
| Literature: ZHEJIANG JIUZHOU PHARMACEAUTICAL CO., LTD.; Gao, Hongjun; Li, Min Patent: US2013/12735 A1, 2013 ; Location in patent: Paragraph 0067 ; |
|
~%
(R)-3-Amino-4-(... CAS#:936630-57-8 |
| Literature: WO2010/122578 A2, ; Page/Page column 59 ; |
|
~%
(R)-3-Amino-4-(... CAS#:936630-57-8 |
| Literature: US2012/16126 A1, ; Page/Page column 7-8 ; US 20120016126 A1 |
|
~%
(R)-3-Amino-4-(... CAS#:936630-57-8 |
| Literature: US2013/12735 A1, ; |
|
~%
(R)-3-Amino-4-(... CAS#:936630-57-8 |
| Literature: US2013/12735 A1, ; |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzenebutanoic acid, β-amino-2,4,5-trifluoro-, (βR)- |
| i01-7533 |
| (3R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoic acid |
| (R)-3-Amino-4-(2,4,5-trifluorophenyl)butyric acid |
| Sitagliptin Impurity 25 |