Magnolignan C structure
|
Common Name | Magnolignan C | ||
|---|---|---|---|---|
| CAS Number | 93697-42-8 | Molecular Weight | 300.35 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 517.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H20O4 | Melting Point | 136-138℃ (methanol ) | |
| MSDS | N/A | Flash Point | 244.0±23.3 °C | |
Use of Magnolignan CMagnolignan C is a lignan, that can be isolated from Magnoliae Cortex[1]. |
| Name | Magnolignan C |
|---|---|
| Synonym | More Synonyms |
| Description | Magnolignan C is a lignan, that can be isolated from Magnoliae Cortex[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.1±45.0 °C at 760 mmHg |
| Melting Point | 136-138℃ (methanol ) |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 |
| Flash Point | 244.0±23.3 °C |
| Exact Mass | 300.136169 |
| PSA | 80.92000 |
| LogP | 1.31 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | LHJCLTLPXXKFTJ-UHFFFAOYSA-N |
| SMILES | C=CCc1cc(-c2cc(CC(O)CO)ccc2O)ccc1O |
| Hazard Codes | Xi |
|---|
| 5-(2,3-dihydroxypropyl)-3'-(prop-2-en-1-yl)biphenyl-2,4'-diol |
| [1,1'-Biphenyl]-2,4'-diol, 5-(2,3-dihydroxypropyl)-3'-(2-propen-1-yl)- |
| 3'-Allyl-5-(2,3-dihydroxypropyl)-2,4'-biphenyldiol |