8-BroMo-3-Methyl-xanthine structure
|
Common Name | 8-BroMo-3-Methyl-xanthine | ||
|---|---|---|---|---|
| CAS Number | 93703-24-3 | Molecular Weight | 245.033 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H5BrN4O2 | Melting Point | 300°C(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Bromo-3-methyl-1H-purine-2,6(3H,7H)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Melting Point | 300°C(lit.) |
| Molecular Formula | C6H5BrN4O2 |
| Molecular Weight | 245.033 |
| Exact Mass | 243.959579 |
| PSA | 83.54000 |
| LogP | -0.63 |
| Index of Refraction | 1.662 |
| InChIKey | QTEQVEJOXGBDGI-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(Br)nc21 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 22 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933990090 |
|
~90%
8-BroMo-3-Methy... CAS#:93703-24-3 |
| Literature: US2002/28823 A1, ; |
|
~85%
8-BroMo-3-Methy... CAS#:93703-24-3 |
| Literature: Chemistry of Heterocyclic Compounds (New York, NY, United States), , vol. 20, # 8 p. 924 - 927 Khimiya Geterotsiklicheskikh Soedinenii, , # 8 p. 1129 - 1132 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Bromo-3-methyl-3,7-dihydro-1H-purine-2,6-dione |
| 2H-purin-2-one, 8-bromo-3,7-dihydro-6-hydroxy-3-methyl- |
| 1H-Purine-2,6-dione, 8-bromo-3,7-dihydro-3-methyl- |
| 8-bromo-3-methyl-7H-purine-2,6-dione |
| 8-Bromo-3-methyl-3,7-dihydropurine-2,6-dione |