7-bromo-1-ethyl-5-methylindole-2,3-dione structure
|
Common Name | 7-bromo-1-ethyl-5-methylindole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 937664-94-3 | Molecular Weight | 268.10700 | |
| Density | 1.553g/cm3 | Boiling Point | 385.289ºC at 760 mmHg | |
| Molecular Formula | C11H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.816ºC | |
| Name | 7-bromo-1-ethyl-5-methylindole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.553g/cm3 |
|---|---|
| Boiling Point | 385.289ºC at 760 mmHg |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.10700 |
| Flash Point | 186.816ºC |
| Exact Mass | 266.98900 |
| PSA | 37.38000 |
| LogP | 2.37170 |
| Index of Refraction | 1.605 |
| InChIKey | YZOKQXZKPAIFCT-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C(=O)c2cc(C)cc(Br)c21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-bromo-1-ethyl-5-methyl-1h-indole-2,3-dione |