1-[(methylcarbamoyl)amino]-1-oxopropan-2-yl4-{[(4-methyl-2-oxo-2h-chromen-7-yl)oxy]methyl}benzoate structure
|
Common Name | 1-[(methylcarbamoyl)amino]-1-oxopropan-2-yl4-{[(4-methyl-2-oxo-2h-chromen-7-yl)oxy]methyl}benzoate | ||
|---|---|---|---|---|
| CAS Number | 937891-74-2 | Molecular Weight | 438.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-[(methylcarbamoyl)amino]-1-oxopropan-2-yl4-{[(4-methyl-2-oxo-2h-chromen-7-yl)oxy]methyl}benzoateMuRF1-IN-2 (Example 3) is a MuRF1 inhibitor. MuRF1-IN-2 can be used for research of muscle wasting conditions, of skeletal or cardial muscle atrophy[1]. |
| Name | 1-[(methylcarbamoyl)amino]-1-oxopropan-2-yl 4-{[(4-methyl-2-oxo-2h-chromen-7-yl)oxy]methyl}benzoate |
|---|
| Description | MuRF1-IN-2 (Example 3) is a MuRF1 inhibitor. MuRF1-IN-2 can be used for research of muscle wasting conditions, of skeletal or cardial muscle atrophy[1]. |
|---|---|
| Related Catalog | |
| Target |
MuRF1[1] |
| References |
| Molecular Formula | C23H22N2O7 |
|---|---|
| Molecular Weight | 438.43 |
| InChIKey | QPLWJVFJFYAMHG-UHFFFAOYSA-N |
| SMILES | CNC(=O)NC(=O)C(C)OC(=O)c1ccc(COc2ccc3c(C)cc(=O)oc3c2)cc1 |
| Storage condition | 2-8°C |