4-Chloro-2-nitrobenzyl chloride structure
|
Common Name | 4-Chloro-2-nitrobenzyl chloride | ||
|---|---|---|---|---|
| CAS Number | 938-71-6 | Molecular Weight | 206.02600 | |
| Density | 1.462g/cm3 | Boiling Point | 308.3ºC at 760mmHg | |
| Molecular Formula | C7H5Cl2NO2 | Melting Point | 38-44ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 140.3ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 4-Chloro-2-nitrobenzyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.462g/cm3 |
|---|---|
| Boiling Point | 308.3ºC at 760mmHg |
| Melting Point | 38-44ºC(lit.) |
| Molecular Formula | C7H5Cl2NO2 |
| Molecular Weight | 206.02600 |
| Flash Point | 140.3ºC |
| Exact Mass | 204.97000 |
| PSA | 45.82000 |
| LogP | 3.51020 |
| Index of Refraction | 1.588 |
| InChIKey | OMPHLGROCARZOU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1CCl |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | 34-36/37 |
| Safety Phrases | S26;S27;S28;S45;S36/S37/S39 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~56%
4-Chloro-2-nitr... CAS#:938-71-6 |
| Literature: Wright, William B.; Greenblatt, Eugene N.; Day, Ivana P.; Quinones, Nicanor Q.; Hardy, Robert A. Journal of Medicinal Chemistry, 1980 , vol. 23, # 4 p. 462 - 465 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
A New Efficient Synthetic Method for 3-Iodothyronamine and Its Potent Hypothermic Efficacy. Kim J-G, et al.
Chin. J. Chem. 29(10) , 2205-8, (2011)
|
| MFCD00007216 |
| EINECS 213-345-9 |